C24H35F3N4O4 — CID 171534273
(2S)-1-[3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-3,3,4-trimethyl-N-[(2S)-1-[(3S)-2-oxopyrrolidin-3-yl]but-3-yn-2-yl]pyrrolidine-2-carboxamide (PubChem CID 171534273) has the molecular formula C24H35F3N4O4 and a molecular weight of 500.56 g/mol. Its IUPAC name is (2S)-1-[3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-3,3,4-trimethyl-N-[(2S)-1-[(3S)-2-oxopyrrolidin-3-yl]but-3-yn-2-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-3,3,4-trimethyl-N-[(2S)-1-[(3S)-2-oxopyrrolidin-3-yl]but-3-yn-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 171534273 |
| Molecular Formula | C24H35F3N4O4 |
| Molecular Weight | 500.56 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | (2S)-1-[3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-3,3,4-trimethyl-N-[(2S)-1-[(3S)-2-oxopyrrolidin-3-yl]but-3-yn-2-yl]pyrrolidine-2-carboxamide |
| SMILES | C#C[C@H](C[C@@H]1CCNC1=O)NC(=O)[C@H]1N(C(=O)C(NC(=O)C(F)(F)F)C(C)(C)C)CC(C)C1(C)C |
| InChI | InChI=1S/C24H35F3N4O4/c1-8-15(11-14-9-10-28-18(14)32)29-19(33)17-23(6,7)13(2)12-31(17)20(34)16(22(3,4)5)30-21(35)24(25,26)27/h1,13-17H,9-12H2,2-7H3,(H,28,32)(H,29,33)(H,30,35)/t13?,14-,15+,16?,17+/m0/s1 |
| InChIKey | RIRKYEFHSWABMP-MNSQOIKPSA-N |
| XLogP | 1.60 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.56 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|