C28H44N4O5 — CID 166157076
(2S,4S)-1-[(2S)-2-(cyclopropanecarbonylamino)-3,3-dimethylbutanoyl]-3,3,4-trimethyl-N-[(2S)-3-oxo-1-[(3S)-2-oxopiperidin-3-yl]pent-4-en-2-yl]pyrrolidine-2-carboxamide (PubChem CID 166157076) has the molecular formula C28H44N4O5 and a molecular weight of 516.68 g/mol. Its IUPAC name is (2S,4S)-1-[(2S)-2-(cyclopropanecarbonylamino)-3,3-dimethylbutanoyl]-3,3,4-trimethyl-N-[(2S)-3-oxo-1-[(3S)-2-oxopiperidin-3-yl]pent-4-en-2-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-1-[(2S)-2-(cyclopropanecarbonylamino)-3,3-dimethylbutanoyl]-3,3,4-trimethyl-N-[(2S)-3-oxo-1-[(3S)-2-oxopiperidin-3-yl]pent-4-en-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 166157076 |
| Molecular Formula | C28H44N4O5 |
| Molecular Weight | 516.68 g/mol |
| Exact Mass | 516.33 |
| IUPAC Name | (2S,4S)-1-[(2S)-2-(cyclopropanecarbonylamino)-3,3-dimethylbutanoyl]-3,3,4-trimethyl-N-[(2S)-3-oxo-1-[(3S)-2-oxopiperidin-3-yl]pent-4-en-2-yl]pyrrolidine-2-carboxamide |
| SMILES | C=CC(=O)[C@H](C[C@@H]1CCCNC1=O)NC(=O)[C@H]1N(C(=O)[C@@H](NC(=O)C2CC2)C(C)(C)C)C[C@@H](C)C1(C)C |
| InChI | InChI=1S/C28H44N4O5/c1-8-20(33)19(14-18-10-9-13-29-23(18)34)30-25(36)22-28(6,7)16(2)15-32(22)26(37)21(27(3,4)5)31-24(35)17-11-12-17/h8,16-19,21-22H,1,9-15H2,2-7H3,(H,29,34)(H,30,36)(H,31,35)/t16-,18+,19+,21-,22-/m1/s1 |
| InChIKey | STLIVTAKHAAODS-ZLJPILQHSA-N |
| XLogP | 1.96 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.68 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|