C31H43FN4O4 — CID 166157111
N-[(2S)-1-[(2S,4S)-2-[(2,2-dimethyl-4-oxohex-5-en-3-yl)carbamoyl]-3,3,4-trimethylpyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]-4-fluoro-1H-indole-2-carboxamide (PubChem CID 166157111) has the molecular formula C31H43FN4O4 and a molecular weight of 554.71 g/mol. Its IUPAC name is N-[(2S)-1-[(2S,4S)-2-[(2,2-dimethyl-4-oxohex-5-en-3-yl)carbamoyl]-3,3,4-trimethylpyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]-4-fluoro-1H-indole-2-carboxamide.
| Compound Name | N-[(2S)-1-[(2S,4S)-2-[(2,2-dimethyl-4-oxohex-5-en-3-yl)carbamoyl]-3,3,4-trimethylpyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]-4-fluoro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 166157111 |
| Molecular Formula | C31H43FN4O4 |
| Molecular Weight | 554.71 g/mol |
| Exact Mass | 554.33 |
| IUPAC Name | N-[(2S)-1-[(2S,4S)-2-[(2,2-dimethyl-4-oxohex-5-en-3-yl)carbamoyl]-3,3,4-trimethylpyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]-4-fluoro-1H-indole-2-carboxamide |
| SMILES | C=CC(=O)C(NC(=O)[C@H]1N(C(=O)[C@@H](NC(=O)c2cc3c(F)cccc3[nH]2)C(C)(C)C)C[C@@H](C)C1(C)C)C(C)(C)C |
| InChI | InChI=1S/C31H43FN4O4/c1-11-22(37)23(29(3,4)5)34-27(39)25-31(9,10)17(2)16-36(25)28(40)24(30(6,7)8)35-26(38)21-15-18-19(32)13-12-14-20(18)33-21/h11-15,17,23-25,33H,1,16H2,2-10H3,(H,34,39)(H,35,38)/t17-,23?,24-,25-/m1/s1 |
| InChIKey | DLLWKGWVAPBNAP-IQDODCHQSA-N |
| XLogP | 4.61 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.71 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|