C30H37FN4O4 — CID 166156722
N-[1-cyclopropyl-2-[(1R,2S,5S)-2-[(2,2-dimethyl-4-oxohex-5-en-3-yl)carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-2-oxoethyl]-4-fluoro-1H-indole-2-carboxamide (PubChem CID 166156722) has the molecular formula C30H37FN4O4 and a molecular weight of 536.65 g/mol. Its IUPAC name is N-[1-cyclopropyl-2-[(1R,2S,5S)-2-[(2,2-dimethyl-4-oxohex-5-en-3-yl)carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-2-oxoethyl]-4-fluoro-1H-indole-2-carboxamide.
| Compound Name | N-[1-cyclopropyl-2-[(1R,2S,5S)-2-[(2,2-dimethyl-4-oxohex-5-en-3-yl)carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-2-oxoethyl]-4-fluoro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 166156722 |
| Molecular Formula | C30H37FN4O4 |
| Molecular Weight | 536.65 g/mol |
| Exact Mass | 536.28 |
| IUPAC Name | N-[1-cyclopropyl-2-[(1R,2S,5S)-2-[(2,2-dimethyl-4-oxohex-5-en-3-yl)carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-2-oxoethyl]-4-fluoro-1H-indole-2-carboxamide |
| SMILES | C=CC(=O)C(NC(=O)[C@@H]1[C@@H]2[C@H](CN1C(=O)C(NC(=O)c1cc3c(F)cccc3[nH]1)C1CC1)C2(C)C)C(C)(C)C |
| InChI | InChI=1S/C30H37FN4O4/c1-7-21(36)25(29(2,3)4)34-27(38)24-22-17(30(22,5)6)14-35(24)28(39)23(15-11-12-15)33-26(37)20-13-16-18(31)9-8-10-19(16)32-20/h7-10,13,15,17,22-25,32H,1,11-12,14H2,2-6H3,(H,33,37)(H,34,38)/t17-,22-,23?,24-,25?/m0/s1 |
| InChIKey | NZVSUWQNIGUJDZ-UUIOIQQPSA-N |
| XLogP | 3.58 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.65 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|