C32H44N4O5 — CID 166156766
N-[(2S)-1-[(1R,2S,5S)-2-[(2,2-dimethyl-4-oxohex-5-en-3-yl)carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-4-methyl-1-oxopentan-2-yl]-4-methoxy-1H-indole-2-carboxamide (PubChem CID 166156766) has the molecular formula C32H44N4O5 and a molecular weight of 564.73 g/mol. Its IUPAC name is N-[(2S)-1-[(1R,2S,5S)-2-[(2,2-dimethyl-4-oxohex-5-en-3-yl)carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-4-methyl-1-oxopentan-2-yl]-4-methoxy-1H-indole-2-carboxamide.
| Compound Name | N-[(2S)-1-[(1R,2S,5S)-2-[(2,2-dimethyl-4-oxohex-5-en-3-yl)carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-4-methyl-1-oxopentan-2-yl]-4-methoxy-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 166156766 |
| Molecular Formula | C32H44N4O5 |
| Molecular Weight | 564.73 g/mol |
| Exact Mass | 564.33 |
| IUPAC Name | N-[(2S)-1-[(1R,2S,5S)-2-[(2,2-dimethyl-4-oxohex-5-en-3-yl)carbamoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-4-methyl-1-oxopentan-2-yl]-4-methoxy-1H-indole-2-carboxamide |
| SMILES | C=CC(=O)C(NC(=O)[C@@H]1[C@@H]2[C@H](CN1C(=O)[C@H](CC(C)C)NC(=O)c1cc3c(OC)cccc3[nH]1)C2(C)C)C(C)(C)C |
| InChI | InChI=1S/C32H44N4O5/c1-10-23(37)27(31(4,5)6)35-29(39)26-25-19(32(25,7)8)16-36(26)30(40)22(14-17(2)3)34-28(38)21-15-18-20(33-21)12-11-13-24(18)41-9/h10-13,15,17,19,22,25-27,33H,1,14,16H2,2-9H3,(H,34,38)(H,35,39)/t19-,22-,25-,26-,27?/m0/s1 |
| InChIKey | UPVWJUZGNOQVHL-TYEZUBRTSA-N |
| XLogP | 4.09 |
| TPSA | 120.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.73 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|