C23H16N2S — CID 164703495
5-(4-phenylphenyl)-1,3-dihydrobenzo[e]benzimidazole-2-thione (PubChem CID 164703495) has the molecular formula C23H16N2S and a molecular weight of 352.46 g/mol. Its IUPAC name is 5-(4-phenylphenyl)-1,3-dihydrobenzo[e]benzimidazole-2-thione.
| Compound Name | 5-(4-phenylphenyl)-1,3-dihydrobenzo[e]benzimidazole-2-thione |
|---|---|
| PubChem CID | 164703495 |
| Molecular Formula | C23H16N2S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 5-(4-phenylphenyl)-1,3-dihydrobenzo[e]benzimidazole-2-thione |
| SMILES | S=c1[nH]c2cc(-c3ccc(-c4ccccc4)cc3)c3ccccc3c2[nH]1 |
| InChI | InChI=1S/C23H16N2S/c26-23-24-21-14-20(18-8-4-5-9-19(18)22(21)25-23)17-12-10-16(11-13-17)15-6-2-1-3-7-15/h1-14H,(H2,24,25,26) |
| InChIKey | KUCNPLSEWCNUNR-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|