C19H13ClN2S — CID 86762103
5-chloro-6-(4-phenylphenyl)-1,3-dihydrobenzimidazole-2-thione (PubChem CID 86762103) has the molecular formula C19H13ClN2S and a molecular weight of 336.85 g/mol. Its IUPAC name is 5-chloro-6-(4-phenylphenyl)-1,3-dihydrobenzimidazole-2-thione.
| Compound Name | 5-chloro-6-(4-phenylphenyl)-1,3-dihydrobenzimidazole-2-thione |
|---|---|
| PubChem CID | 86762103 |
| Molecular Formula | C19H13ClN2S |
| Molecular Weight | 336.85 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 5-chloro-6-(4-phenylphenyl)-1,3-dihydrobenzimidazole-2-thione |
| SMILES | S=c1[nH]c2cc(Cl)c(-c3ccc(-c4ccccc4)cc3)cc2[nH]1 |
| InChI | InChI=1S/C19H13ClN2S/c20-16-11-18-17(21-19(23)22-18)10-15(16)14-8-6-13(7-9-14)12-4-2-1-3-5-12/h1-11H,(H2,21,22,23) |
| InChIKey | PPPCXNGLMATOPN-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.85 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|