C38H24Y-2 — CID 164703612
9-(4-phenylbenzene-5-id-1-yl)-10-(3-phenylphenyl)anthracene;yttrium (PubChem CID 164703612) has the molecular formula C38H24Y-2 and a molecular weight of 569.52 g/mol. Its IUPAC name is 9-(4-phenylbenzene-5-id-1-yl)-10-(3-phenylphenyl)anthracene;yttrium.
| Compound Name | 9-(4-phenylbenzene-5-id-1-yl)-10-(3-phenylphenyl)anthracene;yttrium |
|---|---|
| PubChem CID | 164703612 |
| Molecular Formula | C38H24Y-2 |
| Molecular Weight | 569.52 g/mol |
| Exact Mass | 569.09 |
| IUPAC Name | 9-(4-phenylbenzene-5-id-1-yl)-10-(3-phenylphenyl)anthracene;yttrium |
| SMILES | [Y].[c-]1ccccc1-c1[c-]cc(-c2c3ccccc3c(-c3cccc(-c4ccccc4)c3)c3ccccc23)cc1 |
| InChI | InChI=1S/C38H24.Y/c1-3-12-27(13-4-1)29-22-24-30(25-23-29)37-33-18-7-9-20-35(33)38(36-21-10-8-19-34(36)37)32-17-11-16-31(26-32)28-14-5-2-6-15-28;/h1-12,14-22,24-26H;/q-2; |
| InChIKey | NOMJHXGUUUWQAC-UHFFFAOYSA-N |
| XLogP | 10.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.52 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|