C20H21N3O — CID 164705272
(NZ)-N-[[6-[4-(naphthalen-1-ylamino)butyl]-2-pyridinyl]methylidene]hydroxylamine (PubChem CID 164705272) has the molecular formula C20H21N3O and a molecular weight of 319.41 g/mol. Its IUPAC name is (NZ)-N-[[6-[4-(naphthalen-1-ylamino)butyl]-2-pyridinyl]methylidene]hydroxylamine.
| Compound Name | (NZ)-N-[[6-[4-(naphthalen-1-ylamino)butyl]-2-pyridinyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 164705272 |
| Molecular Formula | C20H21N3O |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | (NZ)-N-[[6-[4-(naphthalen-1-ylamino)butyl]-2-pyridinyl]methylidene]hydroxylamine |
| SMILES | O/N=C\c1cccc(CCCCNc2cccc3ccccc23)n1 |
| InChI | InChI=1S/C20H21N3O/c24-22-15-18-11-6-10-17(23-18)9-3-4-14-21-20-13-5-8-16-7-1-2-12-19(16)20/h1-2,5-8,10-13,15,21,24H,3-4,9,14H2/b22-15- |
| InChIKey | JHJXWNZNGZXINC-JCMHNJIXSA-N |
| XLogP | 4.48 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|