C19H19FN4O — CID 138560123
(NZ)-N-[[3-fluoro-6-[4-(quinolin-4-ylamino)butyl]-2-pyridinyl]methylidene]hydroxylamine (PubChem CID 138560123) has the molecular formula C19H19FN4O and a molecular weight of 338.39 g/mol. Its IUPAC name is (NZ)-N-[[3-fluoro-6-[4-(quinolin-4-ylamino)butyl]-2-pyridinyl]methylidene]hydroxylamine.
| Compound Name | (NZ)-N-[[3-fluoro-6-[4-(quinolin-4-ylamino)butyl]-2-pyridinyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 138560123 |
| Molecular Formula | C19H19FN4O |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | (NZ)-N-[[3-fluoro-6-[4-(quinolin-4-ylamino)butyl]-2-pyridinyl]methylidene]hydroxylamine |
| SMILES | O/N=C\c1nc(CCCCNc2ccnc3ccccc23)ccc1F |
| InChI | InChI=1S/C19H19FN4O/c20-16-9-8-14(24-19(16)13-23-25)5-3-4-11-21-18-10-12-22-17-7-2-1-6-15(17)18/h1-2,6-10,12-13,25H,3-5,11H2,(H,21,22)/b23-13- |
| InChIKey | UOJQIKZXGRMGTM-QRVIBDJDSA-N |
| XLogP | 4.01 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|