C25H30FN3O — CID 138580163
(NE)-N-[[3-fluoro-6-[4-[[(E)-(2-methylcyclohexen-1-yl)-(6-methylidenecyclohexa-2,4-dien-1-ylidene)methyl]amino]butyl]-2-pyridinyl]methylidene]hydroxylamine (PubChem CID 138580163) has the molecular formula C25H30FN3O and a molecular weight of 407.53 g/mol. Its IUPAC name is (NE)-N-[[3-fluoro-6-[4-[[(E)-(2-methylcyclohexen-1-yl)-(6-methylidenecyclohexa-2,4-dien-1-ylidene)methyl]amino]butyl]-2-pyridinyl]methylidene]hydroxylamine.
| Compound Name | (NE)-N-[[3-fluoro-6-[4-[[(E)-(2-methylcyclohexen-1-yl)-(6-methylidenecyclohexa-2,4-dien-1-ylidene)methyl]amino]butyl]-2-pyridinyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 138580163 |
| Molecular Formula | C25H30FN3O |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | (NE)-N-[[3-fluoro-6-[4-[[(E)-(2-methylcyclohexen-1-yl)-(6-methylidenecyclohexa-2,4-dien-1-ylidene)methyl]amino]butyl]-2-pyridinyl]methylidene]hydroxylamine |
| SMILES | C=c1cccc/c1=C(\NCCCCc1ccc(F)c(/C=N/O)n1)C1=C(C)CCCC1 |
| InChI | InChI=1S/C25H30FN3O/c1-18-9-3-5-12-21(18)25(22-13-6-4-10-19(22)2)27-16-8-7-11-20-14-15-23(26)24(29-20)17-28-30/h3,5,9,12,14-15,17,27,30H,1,4,6-8,10-11,13,16H2,2H3/b25-21+,28-17+ |
| InChIKey | KSRBSWLATFDDNY-ZBAFWAKJSA-N |
| XLogP | 4.05 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|