C16H26N4O2 — CID 166959601
6-[5-(3-aminopiperidin-1-yl)pentyl]-2-(hydroxyiminomethyl)pyridin-3-ol (PubChem CID 166959601) has the molecular formula C16H26N4O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is 6-[5-(3-aminopiperidin-1-yl)pentyl]-2-(hydroxyiminomethyl)pyridin-3-ol.
| Compound Name | 6-[5-(3-aminopiperidin-1-yl)pentyl]-2-(hydroxyiminomethyl)pyridin-3-ol |
|---|---|
| PubChem CID | 166959601 |
| Molecular Formula | C16H26N4O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 6-[5-(3-aminopiperidin-1-yl)pentyl]-2-(hydroxyiminomethyl)pyridin-3-ol |
| SMILES | NC1CCCN(CCCCCc2ccc(O)c(C=NO)n2)C1 |
| InChI | InChI=1S/C16H26N4O2/c17-13-5-4-10-20(12-13)9-3-1-2-6-14-7-8-16(21)15(19-14)11-18-22/h7-8,11,13,21-22H,1-6,9-10,12,17H2 |
| InChIKey | YLTDZTTVXLGTEW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 94.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|