C20H26ClN3O2 — CID 172962404
(2E)-2-hydroxyimino-N-[5-(1,2,3,4-tetrahydroacridin-9-yl)pentyl]acetamide;hydrochloride (PubChem CID 172962404) has the molecular formula C20H26ClN3O2 and a molecular weight of 375.90 g/mol. Its IUPAC name is (2E)-2-hydroxyimino-N-[5-(1,2,3,4-tetrahydroacridin-9-yl)pentyl]acetamide;hydrochloride.
| Compound Name | (2E)-2-hydroxyimino-N-[5-(1,2,3,4-tetrahydroacridin-9-yl)pentyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 172962404 |
| Molecular Formula | C20H26ClN3O2 |
| Molecular Weight | 375.90 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | (2E)-2-hydroxyimino-N-[5-(1,2,3,4-tetrahydroacridin-9-yl)pentyl]acetamide;hydrochloride |
| SMILES | Cl.O=C(/C=N/O)NCCCCCc1c2c(nc3ccccc13)CCCC2 |
| InChI | InChI=1S/C20H25N3O2.ClH/c24-20(14-22-25)21-13-7-1-2-8-15-16-9-3-5-11-18(16)23-19-12-6-4-10-17(15)19;/h3,5,9,11,14,25H,1-2,4,6-8,10,12-13H2,(H,21,24);1H/b22-14+; |
| InChIKey | HROSCQUHNCUWLZ-CWUUNJJBSA-N |
| XLogP | 3.82 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.90 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|