C22H30ClN3O2 — CID 172954730
(2E)-2-hydroxyimino-N-[7-(1,2,3,4-tetrahydroacridin-9-yl)heptyl]acetamide;hydrochloride (PubChem CID 172954730) has the molecular formula C22H30ClN3O2 and a molecular weight of 403.95 g/mol. Its IUPAC name is (2E)-2-hydroxyimino-N-[7-(1,2,3,4-tetrahydroacridin-9-yl)heptyl]acetamide;hydrochloride.
| Compound Name | (2E)-2-hydroxyimino-N-[7-(1,2,3,4-tetrahydroacridin-9-yl)heptyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 172954730 |
| Molecular Formula | C22H30ClN3O2 |
| Molecular Weight | 403.95 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | (2E)-2-hydroxyimino-N-[7-(1,2,3,4-tetrahydroacridin-9-yl)heptyl]acetamide;hydrochloride |
| SMILES | Cl.O=C(/C=N/O)NCCCCCCCc1c2c(nc3ccccc13)CCCC2 |
| InChI | InChI=1S/C22H29N3O2.ClH/c26-22(16-24-27)23-15-9-3-1-2-4-10-17-18-11-5-7-13-20(18)25-21-14-8-6-12-19(17)21;/h5,7,11,13,16,27H,1-4,6,8-10,12,14-15H2,(H,23,26);1H/b24-16+; |
| InChIKey | KGPDVXCUTUVHQQ-RSOFWHLMSA-N |
| XLogP | 4.60 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.95 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|