C19H21F2N3O4 — CID 176715129
N'-(4-fluoro-3-hydroxyphenyl)-N-[4-(5-fluoro-6-methoxy-2-pyridinyl)butyl]propanediamide (PubChem CID 176715129) has the molecular formula C19H21F2N3O4 and a molecular weight of 393.39 g/mol. Its IUPAC name is N'-(4-fluoro-3-hydroxyphenyl)-N-[4-(5-fluoro-6-methoxy-2-pyridinyl)butyl]propanediamide.
| Compound Name | N'-(4-fluoro-3-hydroxyphenyl)-N-[4-(5-fluoro-6-methoxy-2-pyridinyl)butyl]propanediamide |
|---|---|
| PubChem CID | 176715129 |
| Molecular Formula | C19H21F2N3O4 |
| Molecular Weight | 393.39 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | N'-(4-fluoro-3-hydroxyphenyl)-N-[4-(5-fluoro-6-methoxy-2-pyridinyl)butyl]propanediamide |
| SMILES | COc1nc(CCCCNC(=O)CC(=O)Nc2ccc(F)c(O)c2)ccc1F |
| InChI | InChI=1S/C19H21F2N3O4/c1-28-19-15(21)8-5-12(24-19)4-2-3-9-22-17(26)11-18(27)23-13-6-7-14(20)16(25)10-13/h5-8,10,25H,2-4,9,11H2,1H3,(H,22,26)(H,23,27) |
| InChIKey | MYUBVNQKTUIJKN-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|