C22H25ClN4O2 — CID 164706988
N-(1-phenylethoxy)-1-[4-(5-pyrrolidin-3-yl-1,2,4-oxadiazol-3-yl)phenyl]ethanimine;hydrochloride (PubChem CID 164706988) has the molecular formula C22H25ClN4O2 and a molecular weight of 412.92 g/mol. Its IUPAC name is N-(1-phenylethoxy)-1-[4-(5-pyrrolidin-3-yl-1,2,4-oxadiazol-3-yl)phenyl]ethanimine;hydrochloride.
| Compound Name | N-(1-phenylethoxy)-1-[4-(5-pyrrolidin-3-yl-1,2,4-oxadiazol-3-yl)phenyl]ethanimine;hydrochloride |
|---|---|
| PubChem CID | 164706988 |
| Molecular Formula | C22H25ClN4O2 |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | N-(1-phenylethoxy)-1-[4-(5-pyrrolidin-3-yl-1,2,4-oxadiazol-3-yl)phenyl]ethanimine;hydrochloride |
| SMILES | CC(=NOC(C)c1ccccc1)c1ccc(-c2noc(C3CCNC3)n2)cc1.Cl |
| InChI | InChI=1S/C22H24N4O2.ClH/c1-15(25-27-16(2)18-6-4-3-5-7-18)17-8-10-19(11-9-17)21-24-22(28-26-21)20-12-13-23-14-20;/h3-11,16,20,23H,12-14H2,1-2H3;1H |
| InChIKey | BXYRWXCNCKFHDT-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 72.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|