C24H23N3O4 — CID 164707155
(2S)-4-(3-but-3-ynyldiazirin-3-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid (PubChem CID 164707155) has the molecular formula C24H23N3O4 and a molecular weight of 417.47 g/mol. Its IUPAC name is (2S)-4-(3-but-3-ynyldiazirin-3-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid.
| Compound Name | (2S)-4-(3-but-3-ynyldiazirin-3-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
|---|---|
| PubChem CID | 164707155 |
| Molecular Formula | C24H23N3O4 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | (2S)-4-(3-but-3-ynyldiazirin-3-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
| SMILES | C#CCCC1(CC[C@H](NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)N=N1 |
| InChI | InChI=1S/C24H23N3O4/c1-2-3-13-24(26-27-24)14-12-21(22(28)29)25-23(30)31-15-20-18-10-6-4-8-16(18)17-9-5-7-11-19(17)20/h1,4-11,20-21H,3,12-15H2,(H,25,30)(H,28,29)/t21-/m0/s1 |
| InChIKey | BZOLBJRAPBAEAZ-NRFANRHFSA-N |
| XLogP | 4.33 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|