C36H39CuN5O5 — CID 164708423
copper (17S,18S)-18-(2-carboxyethyl)-12-ethenyl-7-ethyl-20-[2-(ethylamino)-2-oxoethyl]-3,8,13,17-tetramethyl-17,18-dihydroporphyrin-21,23-diide-2-carboxylic acid (PubChem CID 164708423) has the molecular formula C36H39CuN5O5 and a molecular weight of 685.28 g/mol. Its IUPAC name is copper (17S,18S)-18-(2-carboxyethyl)-12-ethenyl-7-ethyl-20-[2-(ethylamino)-2-oxoethyl]-3,8,13,17-tetramethyl-17,18-dihydroporphyrin-21,23-diide-2-carboxylic acid.
| Compound Name | copper (17S,18S)-18-(2-carboxyethyl)-12-ethenyl-7-ethyl-20-[2-(ethylamino)-2-oxoethyl]-3,8,13,17-tetramethyl-17,18-dihydroporphyrin-21,23-diide-2-carboxylic acid |
|---|---|
| PubChem CID | 164708423 |
| Molecular Formula | C36H39CuN5O5 |
| Molecular Weight | 685.28 g/mol |
| Exact Mass | 684.22 |
| IUPAC Name | copper (17S,18S)-18-(2-carboxyethyl)-12-ethenyl-7-ethyl-20-[2-(ethylamino)-2-oxoethyl]-3,8,13,17-tetramethyl-17,18-dihydroporphyrin-21,23-diide-2-carboxylic acid |
| SMILES | C=Cc1c(C)c2cc3nc(c(CC(=O)NCC)c4[n-]c(cc5nc(cc1[n-]2)C(C)=C5CC)c(C)c4C(=O)O)[C@@H](CCC(=O)O)[C@@H]3C.[Cu+2] |
| InChI | InChI=1S/C36H41N5O5.Cu/c1-8-21-17(4)25-14-27-19(6)23(11-12-32(43)44)34(40-27)24(13-31(42)37-10-3)35-33(36(45)46)20(7)28(41-35)16-30-22(9-2)18(5)26(39-30)15-29(21)38-25;/h8,14-16,19,23H,1,9-13H2,2-7H3,(H5,37,38,39,40,41,42,43,44,45,46);/q;+2/p-2/t19-,23-;/m0./s1 |
| InChIKey | IGCKLDPEGCXRSR-ZWHLOQRUSA-L |
| XLogP | 6.30 |
| TPSA | 157.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.28 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |