C26H12BrClF5NO — CID 164708846
N-(3-bromo-5-chlorophenyl)-2-(2,3,4,5,6-pentafluorophenyl)-N-phenyl-1-benzofuran-6-amine (PubChem CID 164708846) has the molecular formula C26H12BrClF5NO and a molecular weight of 564.74 g/mol. Its IUPAC name is N-(3-bromo-5-chlorophenyl)-2-(2,3,4,5,6-pentafluorophenyl)-N-phenyl-1-benzofuran-6-amine.
| Compound Name | N-(3-bromo-5-chlorophenyl)-2-(2,3,4,5,6-pentafluorophenyl)-N-phenyl-1-benzofuran-6-amine |
|---|---|
| PubChem CID | 164708846 |
| Molecular Formula | C26H12BrClF5NO |
| Molecular Weight | 564.74 g/mol |
| Exact Mass | 562.97 |
| IUPAC Name | N-(3-bromo-5-chlorophenyl)-2-(2,3,4,5,6-pentafluorophenyl)-N-phenyl-1-benzofuran-6-amine |
| SMILES | Fc1c(F)c(F)c(-c2cc3ccc(N(c4ccccc4)c4cc(Cl)cc(Br)c4)cc3o2)c(F)c1F |
| InChI | InChI=1S/C26H12BrClF5NO/c27-14-9-15(28)11-18(10-14)34(16-4-2-1-3-5-16)17-7-6-13-8-20(35-19(13)12-17)21-22(29)24(31)26(33)25(32)23(21)30/h1-12H |
| InChIKey | OMKPOKNDYZWVMQ-UHFFFAOYSA-N |
| XLogP | 9.68 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.74 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|