C11H22F2N2 — CID 164709883
1-tert-butyl-4-ethyl-6,6-difluoro-1,4-diazepane (PubChem CID 164709883) has the molecular formula C11H22F2N2 and a molecular weight of 220.31 g/mol. Its IUPAC name is 1-tert-butyl-4-ethyl-6,6-difluoro-1,4-diazepane.
| Compound Name | 1-tert-butyl-4-ethyl-6,6-difluoro-1,4-diazepane |
|---|---|
| PubChem CID | 164709883 |
| Molecular Formula | C11H22F2N2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 1-tert-butyl-4-ethyl-6,6-difluoro-1,4-diazepane |
| SMILES | CCN1CCN(C(C)(C)C)CC(F)(F)C1 |
| InChI | InChI=1S/C11H22F2N2/c1-5-14-6-7-15(10(2,3)4)9-11(12,13)8-14/h5-9H2,1-4H3 |
| InChIKey | JCGLAKVDPGVGHF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |