C8H17FN2 — CID 123186695
1-(2-fluoroethyl)-4-methyl-1,4-diazepane (PubChem CID 123186695) has the molecular formula C8H17FN2 and a molecular weight of 160.24 g/mol. Its IUPAC name is 1-(2-fluoroethyl)-4-methyl-1,4-diazepane.
| Compound Name | 1-(2-fluoroethyl)-4-methyl-1,4-diazepane |
|---|---|
| PubChem CID | 123186695 |
| Molecular Formula | C8H17FN2 |
| Molecular Weight | 160.24 g/mol |
| Exact Mass | 160.14 |
| IUPAC Name | 1-(2-fluoroethyl)-4-methyl-1,4-diazepane |
| SMILES | CN1CCCN(CCF)CC1 |
| InChI | InChI=1S/C8H17FN2/c1-10-4-2-5-11(6-3-9)8-7-10/h2-8H2,1H3 |
| InChIKey | TXKIXVRBBWEXNH-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.24 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |