C23H15FN2S — CID 164712711
8-[4-(dideuteriomethyl)-5-phenyl-2-pyridinyl]-2-fluoro-[1]benzothiolo[2,3-b]pyridine (PubChem CID 164712711) has the molecular formula C23H15FN2S and a molecular weight of 372.46 g/mol. Its IUPAC name is 8-[4-(dideuteriomethyl)-5-phenyl-2-pyridinyl]-2-fluoro-[1]benzothiolo[2,3-b]pyridine.
| Compound Name | 8-[4-(dideuteriomethyl)-5-phenyl-2-pyridinyl]-2-fluoro-[1]benzothiolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 164712711 |
| Molecular Formula | C23H15FN2S |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 8-[4-(dideuteriomethyl)-5-phenyl-2-pyridinyl]-2-fluoro-[1]benzothiolo[2,3-b]pyridine |
| SMILES | [2H]C([2H])c1cc(-c2cccc3c2sc2nc(F)ccc23)ncc1-c1ccccc1 |
| InChI | InChI=1S/C23H15FN2S/c1-14-12-20(25-13-19(14)15-6-3-2-4-7-15)18-9-5-8-16-17-10-11-21(24)26-23(17)27-22(16)18/h2-13H,1H3/i1D2 |
| InChIKey | LFJQCQRAIDRRJI-DICFDUPASA-N |
| XLogP | 6.63 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|