C44H28N4O — CID 164716715
8-(2,6-dipyridin-2-yl-4-pyridinyl)-1,2,4-triphenylfuro[2,3-c]quinoline (PubChem CID 164716715) has the molecular formula C44H28N4O and a molecular weight of 628.74 g/mol. Its IUPAC name is 8-(2,6-dipyridin-2-yl-4-pyridinyl)-1,2,4-triphenylfuro[2,3-c]quinoline.
| Compound Name | 8-(2,6-dipyridin-2-yl-4-pyridinyl)-1,2,4-triphenylfuro[2,3-c]quinoline |
|---|---|
| PubChem CID | 164716715 |
| Molecular Formula | C44H28N4O |
| Molecular Weight | 628.74 g/mol |
| Exact Mass | 628.23 |
| IUPAC Name | 8-(2,6-dipyridin-2-yl-4-pyridinyl)-1,2,4-triphenylfuro[2,3-c]quinoline |
| SMILES | c1ccc(-c2oc3c(-c4ccccc4)nc4ccc(-c5cc(-c6ccccn6)nc(-c6ccccn6)c5)cc4c3c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C44H28N4O/c1-4-14-29(15-5-1)40-41-34-26-32(33-27-38(36-20-10-12-24-45-36)47-39(28-33)37-21-11-13-25-46-37)22-23-35(34)48-42(30-16-6-2-7-17-30)44(41)49-43(40)31-18-8-3-9-19-31/h1-28H |
| InChIKey | DAUCRMMYYYDDLW-UHFFFAOYSA-N |
| XLogP | 11.17 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.74 |
| LogP ≤ 5 | 11.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |