C48H30N6O — CID 164716756
8-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4-phenyl-1,2-dipyridin-3-ylfuro[2,3-c]quinoline (PubChem CID 164716756) has the molecular formula C48H30N6O and a molecular weight of 706.81 g/mol. Its IUPAC name is 8-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4-phenyl-1,2-dipyridin-3-ylfuro[2,3-c]quinoline.
| Compound Name | 8-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4-phenyl-1,2-dipyridin-3-ylfuro[2,3-c]quinoline |
|---|---|
| PubChem CID | 164716756 |
| Molecular Formula | C48H30N6O |
| Molecular Weight | 706.81 g/mol |
| Exact Mass | 706.25 |
| IUPAC Name | 8-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4-phenyl-1,2-dipyridin-3-ylfuro[2,3-c]quinoline |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(-c4ccc5nc(-c6ccccc6)c6oc(-c7cccnc7)c(-c7cccnc7)c6c5c4)cc3)n2)cc1 |
| InChI | InChI=1S/C48H30N6O/c1-4-12-32(13-5-1)43-45-42(41(37-18-10-26-49-29-37)44(55-45)38-19-11-27-50-30-38)39-28-36(24-25-40(39)51-43)31-20-22-35(23-21-31)48-53-46(33-14-6-2-7-15-33)52-47(54-48)34-16-8-3-9-17-34/h1-30H |
| InChIKey | VLKWOKVMVLHZDV-UHFFFAOYSA-N |
| XLogP | 11.62 |
| TPSA | 90.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.81 |
| LogP ≤ 5 | 11.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |