C54H34N4O — CID 164716017
8-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4-naphthalen-2-yl-2,3-diphenylfuro[3,2-c]quinoline (PubChem CID 164716017) has the molecular formula C54H34N4O and a molecular weight of 754.89 g/mol. Its IUPAC name is 8-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4-naphthalen-2-yl-2,3-diphenylfuro[3,2-c]quinoline.
| Compound Name | 8-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4-naphthalen-2-yl-2,3-diphenylfuro[3,2-c]quinoline |
|---|---|
| PubChem CID | 164716017 |
| Molecular Formula | C54H34N4O |
| Molecular Weight | 754.89 g/mol |
| Exact Mass | 754.27 |
| IUPAC Name | 8-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4-naphthalen-2-yl-2,3-diphenylfuro[3,2-c]quinoline |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(-c4ccc5nc(-c6ccc7ccccc7c6)c6c(-c7ccccc7)c(-c7ccccc7)oc6c5c4)cc3)n2)cc1 |
| InChI | InChI=1S/C54H34N4O/c1-5-16-37(17-6-1)47-48-49(44-30-27-35-15-13-14-24-42(35)33-44)55-46-32-31-43(34-45(46)51(48)59-50(47)38-18-7-2-8-19-38)36-25-28-41(29-26-36)54-57-52(39-20-9-3-10-21-39)56-53(58-54)40-22-11-4-12-23-40/h1-34H |
| InChIKey | MZUCANPBFHRKNP-UHFFFAOYSA-N |
| XLogP | 13.99 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.89 |
| LogP ≤ 5 | 13.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |