C56H36N4O — CID 164716861
2-[3-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-3,4-diphenylfuro[3,2-c]quinoline (PubChem CID 164716861) has the molecular formula C56H36N4O and a molecular weight of 780.93 g/mol. Its IUPAC name is 2-[3-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-3,4-diphenylfuro[3,2-c]quinoline.
| Compound Name | 2-[3-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-3,4-diphenylfuro[3,2-c]quinoline |
|---|---|
| PubChem CID | 164716861 |
| Molecular Formula | C56H36N4O |
| Molecular Weight | 780.93 g/mol |
| Exact Mass | 780.29 |
| IUPAC Name | 2-[3-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-3,4-diphenylfuro[3,2-c]quinoline |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccc(-c5ccccc5)cc4)nc(-c4cccc(-c5oc6c(c(-c7ccccc7)nc7ccccc76)c5-c5ccccc5)c4)n3)cc2)cc1 |
| InChI | InChI=1S/C56H36N4O/c1-5-16-37(17-6-1)39-28-32-43(33-29-39)54-58-55(44-34-30-40(31-35-44)38-18-7-2-8-19-38)60-56(59-54)46-25-15-24-45(36-46)52-49(41-20-9-3-10-21-41)50-51(42-22-11-4-12-23-42)57-48-27-14-13-26-47(48)53(50)61-52/h1-36H |
| InChIKey | ILZBEDYIXBEUBO-UHFFFAOYSA-N |
| XLogP | 14.50 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.93 |
| LogP ≤ 5 | 14.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |