C50H32N4O — CID 164716190
7-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,3,4-triphenylfuro[3,2-c]quinoline (PubChem CID 164716190) has the molecular formula C50H32N4O and a molecular weight of 704.83 g/mol. Its IUPAC name is 7-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,3,4-triphenylfuro[3,2-c]quinoline.
| Compound Name | 7-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,3,4-triphenylfuro[3,2-c]quinoline |
|---|---|
| PubChem CID | 164716190 |
| Molecular Formula | C50H32N4O |
| Molecular Weight | 704.83 g/mol |
| Exact Mass | 704.26 |
| IUPAC Name | 7-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2,3,4-triphenylfuro[3,2-c]quinoline |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc(-c4ccc5c(c4)nc(-c4ccccc4)c4c(-c6ccccc6)c(-c6ccccc6)oc45)c3)n2)cc1 |
| InChI | InChI=1S/C50H32N4O/c1-6-17-33(18-7-1)43-44-45(34-19-8-2-9-20-34)51-42-32-39(29-30-41(42)47(44)55-46(43)35-21-10-3-11-22-35)38-27-16-28-40(31-38)50-53-48(36-23-12-4-13-24-36)52-49(54-50)37-25-14-5-15-26-37/h1-32H |
| InChIKey | MLVWTUDCBFPJJW-UHFFFAOYSA-N |
| XLogP | 12.84 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.83 |
| LogP ≤ 5 | 12.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |