C28H34BF2N2O6 — CID 164717130
CID 164717130 (PubChem CID 164717130) has the molecular formula C28H34BF2N2O6 and a molecular weight of 543.40 g/mol.
| Compound Name | CID 164717130 |
|---|---|
| PubChem CID | 164717130 |
| Molecular Formula | C28H34BF2N2O6 |
| Molecular Weight | 543.40 g/mol |
| Exact Mass | 543.25 |
| IUPAC Name | — |
| SMILES | COC(=O)[C@@H]1CCCN1Cc1cc2nc(-c3cccc([B]OC(C)(C)C(C)(C)O)c3C)oc2cc1OC(F)F |
| InChI | InChI=1S/C28H34BF2N2O6/c1-16-18(9-7-10-19(16)29-39-28(4,5)27(2,3)35)24-32-20-13-17(22(38-26(30)31)14-23(20)37-24)15-33-12-8-11-21(33)25(34)36-6/h7,9-10,13-14,21,26,35H,8,11-12,15H2,1-6H3/t21-/m0/s1 |
| InChIKey | VFQXBTLCTDGQAJ-NRFANRHFSA-N |
| XLogP | 4.35 |
| TPSA | 94.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.40 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|