C92H95BBrF4N10O10 — CID 165005912
CID 165005912 (PubChem CID 165005912) has the molecular formula C92H95BBrF4N10O10 and a molecular weight of 1667.54 g/mol.
| Compound Name | CID 165005912 |
|---|---|
| PubChem CID | 165005912 |
| Molecular Formula | C92H95BBrF4N10O10 |
| Molecular Weight | 1667.54 g/mol |
| Exact Mass | 1665.64 |
| IUPAC Name | — |
| SMILES | COC(=O)[C@@H]1CCCN1Cc1cc2nc(-c3cccc(-c4cccc(C5=Nc6cc(CN7CCCC7)cc(C#N)c6C5)c4C)c3C)oc2cc1OC(F)F.COC(=O)[C@@H]1CCCN1Cc1cc2nc(-c3cccc([B]OC(C)(C)C(C)(C)O)c3C)oc2cc1OC(F)F.Cc1c(Br)cccc1C1=Nc2cc(CN3CCCC3)cc(C#N)c2C1 |
| InChI | InChI=1S/C43H41F2N5O4.C28H34BF2N2O6.C21H20BrN3/c1-25-30(9-6-11-32(25)36-20-34-28(22-46)17-27(18-35(34)47-36)23-49-14-4-5-15-49)31-10-7-12-33(26(31)2)41-48-37-19-29(39(54-43(44)45)21-40(37)53-41)24-50-16-8-13-38(50)42(51)52-3;1-16-18(9-7-10-19(16)29-39-28(4,5)27(2,3)35)24-32-20-13-17(22(38-26(30)31)14-23(20)37-24)15-33-12-8-11-21(33)25(34)36-6;1-14-17(5-4-6-19(14)22)21-11-18-16(12-23)9-15(10-20(18)24-21)13-25-7-2-3-8-25/h6-7,9-12,17-19,21,38,43H,4-5,8,13-16,20,23-24H2,1-3H3;7,9-10,13-14,21,26,35H,8,11-12,15H2,1-6H3;4-6,9-10H,2-3,7-8,11,13H2,1H3/t38-;21-;/m00./s1 |
| InChIKey | NUOBSFLXOMYWAA-UBZORORQSA-N |
| XLogP | 17.92 |
| TPSA | 237.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 118 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1667.54 |
| LogP ≤ 5 | 17.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|