C12H12ClFN4O — CID 164718670
(2-chloro-5-fluoro-3-pyridinyl)-[1-(cyclopropylmethyl)triazol-4-yl]methanol (PubChem CID 164718670) has the molecular formula C12H12ClFN4O and a molecular weight of 282.71 g/mol. Its IUPAC name is (2-chloro-5-fluoro-3-pyridinyl)-[1-(cyclopropylmethyl)triazol-4-yl]methanol.
| Compound Name | (2-chloro-5-fluoro-3-pyridinyl)-[1-(cyclopropylmethyl)triazol-4-yl]methanol |
|---|---|
| PubChem CID | 164718670 |
| Molecular Formula | C12H12ClFN4O |
| Molecular Weight | 282.71 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | (2-chloro-5-fluoro-3-pyridinyl)-[1-(cyclopropylmethyl)triazol-4-yl]methanol |
| SMILES | OC(c1cn(CC2CC2)nn1)c1cc(F)cnc1Cl |
| InChI | InChI=1S/C12H12ClFN4O/c13-12-9(3-8(14)4-15-12)11(19)10-6-18(17-16-10)5-7-1-2-7/h3-4,6-7,11,19H,1-2,5H2 |
| InChIKey | BDNBBIGDERQFDR-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.71 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|