C17H18FIN4O — CID 164718888
(3-ethyl-1-methylpyrazol-5-yl)-[2-(4-fluoro-2-iodophenyl)-5-methylpyrazol-3-yl]methanol (PubChem CID 164718888) has the molecular formula C17H18FIN4O and a molecular weight of 440.26 g/mol. Its IUPAC name is (3-ethyl-1-methylpyrazol-5-yl)-[2-(4-fluoro-2-iodophenyl)-5-methylpyrazol-3-yl]methanol.
| Compound Name | (3-ethyl-1-methylpyrazol-5-yl)-[2-(4-fluoro-2-iodophenyl)-5-methylpyrazol-3-yl]methanol |
|---|---|
| PubChem CID | 164718888 |
| Molecular Formula | C17H18FIN4O |
| Molecular Weight | 440.26 g/mol |
| Exact Mass | 440.05 |
| IUPAC Name | (3-ethyl-1-methylpyrazol-5-yl)-[2-(4-fluoro-2-iodophenyl)-5-methylpyrazol-3-yl]methanol |
| SMILES | CCc1cc(C(O)c2cc(C)nn2-c2ccc(F)cc2I)n(C)n1 |
| InChI | InChI=1S/C17H18FIN4O/c1-4-12-9-15(22(3)21-12)17(24)16-7-10(2)20-23(16)14-6-5-11(18)8-13(14)19/h5-9,17,24H,4H2,1-3H3 |
| InChIKey | JFWZCRNVROPUPG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.26 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|