C14H12FIN4S — CID 164718963
4-[(1-ethyltriazol-4-yl)methyl]-3-(4-fluoro-2-iodophenyl)-1,2-thiazole (PubChem CID 164718963) has the molecular formula C14H12FIN4S and a molecular weight of 414.25 g/mol. Its IUPAC name is 4-[(1-ethyltriazol-4-yl)methyl]-3-(4-fluoro-2-iodophenyl)-1,2-thiazole.
| Compound Name | 4-[(1-ethyltriazol-4-yl)methyl]-3-(4-fluoro-2-iodophenyl)-1,2-thiazole |
|---|---|
| PubChem CID | 164718963 |
| Molecular Formula | C14H12FIN4S |
| Molecular Weight | 414.25 g/mol |
| Exact Mass | 413.98 |
| IUPAC Name | 4-[(1-ethyltriazol-4-yl)methyl]-3-(4-fluoro-2-iodophenyl)-1,2-thiazole |
| SMILES | CCn1cc(Cc2csnc2-c2ccc(F)cc2I)nn1 |
| InChI | InChI=1S/C14H12FIN4S/c1-2-20-7-11(17-19-20)5-9-8-21-18-14(9)12-4-3-10(15)6-13(12)16/h3-4,6-8H,2,5H2,1H3 |
| InChIKey | ISJIBDDMSTVDMM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.25 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|