C40H31N3O2Pt — CID 164721141
CID 164721141 (PubChem CID 164721141) has the molecular formula C40H31N3O2Pt and a molecular weight of 780.79 g/mol.
| Compound Name | CID 164721141 |
|---|---|
| PubChem CID | 164721141 |
| Molecular Formula | C40H31N3O2Pt |
| Molecular Weight | 780.79 g/mol |
| Exact Mass | 780.21 |
| IUPAC Name | — |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1ccnc1-c1[c-]c(Oc2[c-]c3c(cc2)ccc2c3ncc3oc4ccccc4c32)ccc1.[Pt+2] |
| InChI | InChI=1S/C40H31N3O2.Pt/c1-24(2)30-12-8-13-31(25(3)4)39(30)43-20-19-41-40(43)27-9-7-10-28(21-27)44-29-17-15-26-16-18-33-37-32-11-5-6-14-35(32)45-36(37)23-42-38(33)34(26)22-29;/h5-20,23-25H,1-4H3;/q-2;+2 |
| InChIKey | USVYQOPXBFNFFO-UHFFFAOYSA-N |
| XLogP | 10.78 |
| TPSA | 53.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.79 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|