C29H29F3N2O4 — CID 164725170
2-[[2,5-dimethyl-4-[2,2,2-trifluoro-1-(2,4,5-trimethylphenyl)ethyl]phenyl]carbamoyl]-4-(methylcarbamoyl)benzoic acid (PubChem CID 164725170) has the molecular formula C29H29F3N2O4 and a molecular weight of 526.56 g/mol. Its IUPAC name is 2-[[2,5-dimethyl-4-[2,2,2-trifluoro-1-(2,4,5-trimethylphenyl)ethyl]phenyl]carbamoyl]-4-(methylcarbamoyl)benzoic acid.
| Compound Name | 2-[[2,5-dimethyl-4-[2,2,2-trifluoro-1-(2,4,5-trimethylphenyl)ethyl]phenyl]carbamoyl]-4-(methylcarbamoyl)benzoic acid |
|---|---|
| PubChem CID | 164725170 |
| Molecular Formula | C29H29F3N2O4 |
| Molecular Weight | 526.56 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | 2-[[2,5-dimethyl-4-[2,2,2-trifluoro-1-(2,4,5-trimethylphenyl)ethyl]phenyl]carbamoyl]-4-(methylcarbamoyl)benzoic acid |
| SMILES | CNC(=O)c1ccc(C(=O)O)c(C(=O)Nc2cc(C)c(C(c3cc(C)c(C)cc3C)C(F)(F)F)cc2C)c1 |
| InChI | InChI=1S/C29H29F3N2O4/c1-14-9-16(3)21(10-15(14)2)25(29(30,31)32)22-11-18(5)24(12-17(22)4)34-27(36)23-13-19(26(35)33-6)7-8-20(23)28(37)38/h7-13,25H,1-6H3,(H,33,35)(H,34,36)(H,37,38) |
| InChIKey | KIEWZUBMPWFXKJ-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.56 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |