C49H35N4OPtSi-3 — CID 164725453
platinum;triphenyl-[2-[2-[3-[3-(trideuteriomethyl)-2H-benzimidazol-2-id-1-yl]benzene-2-id-1-yl]oxy-1H-carbazol-1-id-9-yl]-4-pyridinyl]silane (PubChem CID 164725453) has the molecular formula C49H35N4OPtSi-3 and a molecular weight of 922.03 g/mol. Its IUPAC name is platinum;triphenyl-[2-[2-[3-[3-(trideuteriomethyl)-2H-benzimidazol-2-id-1-yl]benzene-2-id-1-yl]oxy-1H-carbazol-1-id-9-yl]-4-pyridinyl]silane.
| Compound Name | platinum;triphenyl-[2-[2-[3-[3-(trideuteriomethyl)-2H-benzimidazol-2-id-1-yl]benzene-2-id-1-yl]oxy-1H-carbazol-1-id-9-yl]-4-pyridinyl]silane |
|---|---|
| PubChem CID | 164725453 |
| Molecular Formula | C49H35N4OPtSi-3 |
| Molecular Weight | 922.03 g/mol |
| Exact Mass | 921.24 |
| IUPAC Name | platinum;triphenyl-[2-[2-[3-[3-(trideuteriomethyl)-2H-benzimidazol-2-id-1-yl]benzene-2-id-1-yl]oxy-1H-carbazol-1-id-9-yl]-4-pyridinyl]silane |
| SMILES | [2H]C([2H])([2H])N1[CH-]N(c2[c-]c(Oc3[c-]c4c(cc3)c3ccccc3n4-c3cc([Si](c4ccccc4)(c4ccccc4)c4ccccc4)ccn3)ccc2)c2ccccc21.[Pt] |
| InChI | InChI=1S/C49H35N4OSi.Pt/c1-51-35-52(47-27-14-13-26-46(47)51)36-16-15-17-37(32-36)54-38-28-29-44-43-24-11-12-25-45(43)53(48(44)33-38)49-34-42(30-31-50-49)55(39-18-5-2-6-19-39,40-20-7-3-8-21-40)41-22-9-4-10-23-41;/h2-31,34-35H,1H3;/q-3;/i1D3; |
| InChIKey | UYSPURLFXQNAPU-NIIDSAIPSA-N |
| XLogP | 8.65 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 922.03 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|