C54H37N4OPtSi-3 — CID 177105195
platinum;triphenyl-[2-[2-[3-(3-phenyl-2H-benzimidazol-2-id-1-yl)benzene-2-id-1-yl]oxy-1H-carbazol-1-id-9-yl]-4-pyridinyl]silane (PubChem CID 177105195) has the molecular formula C54H37N4OPtSi-3 and a molecular weight of 981.08 g/mol. Its IUPAC name is platinum;triphenyl-[2-[2-[3-(3-phenyl-2H-benzimidazol-2-id-1-yl)benzene-2-id-1-yl]oxy-1H-carbazol-1-id-9-yl]-4-pyridinyl]silane.
| Compound Name | platinum;triphenyl-[2-[2-[3-(3-phenyl-2H-benzimidazol-2-id-1-yl)benzene-2-id-1-yl]oxy-1H-carbazol-1-id-9-yl]-4-pyridinyl]silane |
|---|---|
| PubChem CID | 177105195 |
| Molecular Formula | C54H37N4OPtSi-3 |
| Molecular Weight | 981.08 g/mol |
| Exact Mass | 980.24 |
| IUPAC Name | platinum;triphenyl-[2-[2-[3-(3-phenyl-2H-benzimidazol-2-id-1-yl)benzene-2-id-1-yl]oxy-1H-carbazol-1-id-9-yl]-4-pyridinyl]silane |
| SMILES | [Pt].[c-]1c(Oc2[c-]c3c(cc2)c2ccccc2n3-c2cc([Si](c3ccccc3)(c3ccccc3)c3ccccc3)ccn2)cccc1N1[CH-]N(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C54H37N4OSi.Pt/c1-5-18-40(19-6-1)56-39-57(52-31-16-15-30-51(52)56)41-20-17-21-42(36-41)59-43-32-33-49-48-28-13-14-29-50(48)58(53(49)37-43)54-38-47(34-35-55-54)60(44-22-7-2-8-23-44,45-24-9-3-10-25-45)46-26-11-4-12-27-46;/h1-35,38-39H;/q-3; |
| InChIKey | JFAOKQXWMZXLRY-UHFFFAOYSA-N |
| XLogP | 10.36 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 981.08 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|