C48H35N4OPt-3 — CID 176783278
9-(4-tert-butyl-2-pyridinyl)-2-[3-(3-phenanthren-3-yl-2H-benzimidazol-2-id-1-yl)benzene-2-id-1-yl]oxy-1H-carbazol-1-ide;platinum (PubChem CID 176783278) has the molecular formula C48H35N4OPt-3 and a molecular weight of 878.91 g/mol. Its IUPAC name is 9-(4-tert-butyl-2-pyridinyl)-2-[3-(3-phenanthren-3-yl-2H-benzimidazol-2-id-1-yl)benzene-2-id-1-yl]oxy-1H-carbazol-1-ide;platinum.
| Compound Name | 9-(4-tert-butyl-2-pyridinyl)-2-[3-(3-phenanthren-3-yl-2H-benzimidazol-2-id-1-yl)benzene-2-id-1-yl]oxy-1H-carbazol-1-ide;platinum |
|---|---|
| PubChem CID | 176783278 |
| Molecular Formula | C48H35N4OPt-3 |
| Molecular Weight | 878.91 g/mol |
| Exact Mass | 878.25 |
| IUPAC Name | 9-(4-tert-butyl-2-pyridinyl)-2-[3-(3-phenanthren-3-yl-2H-benzimidazol-2-id-1-yl)benzene-2-id-1-yl]oxy-1H-carbazol-1-ide;platinum |
| SMILES | CC(C)(C)c1ccnc(-n2c3[c-]c(Oc4[c-]c(N5[CH-]N(c6ccc7ccc8ccccc8c7c6)c6ccccc65)ccc4)ccc3c3ccccc32)c1.[Pt] |
| InChI | InChI=1S/C48H35N4O.Pt/c1-48(2,3)34-25-26-49-47(27-34)52-43-16-7-6-15-40(43)41-24-23-38(30-46(41)52)53-37-13-10-12-35(28-37)50-31-51(45-18-9-8-17-44(45)50)36-22-21-33-20-19-32-11-4-5-14-39(32)42(33)29-36;/h4-27,29,31H,1-3H3;/q-3; |
| InChIKey | WKWNSAPPLRHLTJ-UHFFFAOYSA-N |
| XLogP | 12.58 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 878.91 |
| LogP ≤ 5 | 12.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|