C47H34N5OPt-3 — CID 176782104
9-(4-tert-butyl-2-pyridinyl)-2-[3-(3-phenanthren-3-yl-2H-imidazo[4,5-c]pyridin-2-id-1-yl)benzene-2-id-1-yl]oxy-1H-carbazol-1-ide;platinum (PubChem CID 176782104) has the molecular formula C47H34N5OPt-3 and a molecular weight of 879.90 g/mol. Its IUPAC name is 9-(4-tert-butyl-2-pyridinyl)-2-[3-(3-phenanthren-3-yl-2H-imidazo[4,5-c]pyridin-2-id-1-yl)benzene-2-id-1-yl]oxy-1H-carbazol-1-ide;platinum.
| Compound Name | 9-(4-tert-butyl-2-pyridinyl)-2-[3-(3-phenanthren-3-yl-2H-imidazo[4,5-c]pyridin-2-id-1-yl)benzene-2-id-1-yl]oxy-1H-carbazol-1-ide;platinum |
|---|---|
| PubChem CID | 176782104 |
| Molecular Formula | C47H34N5OPt-3 |
| Molecular Weight | 879.90 g/mol |
| Exact Mass | 879.24 |
| IUPAC Name | 9-(4-tert-butyl-2-pyridinyl)-2-[3-(3-phenanthren-3-yl-2H-imidazo[4,5-c]pyridin-2-id-1-yl)benzene-2-id-1-yl]oxy-1H-carbazol-1-ide;platinum |
| SMILES | CC(C)(C)c1ccnc(-n2c3[c-]c(Oc4[c-]c(N5[CH-]N(c6ccc7ccc8ccccc8c7c6)c6cnccc65)ccc4)ccc3c3ccccc32)c1.[Pt] |
| InChI | InChI=1S/C47H34N5O.Pt/c1-47(2,3)33-21-24-49-46(25-33)52-42-14-7-6-13-39(42)40-20-19-37(28-44(40)52)53-36-11-8-10-34(26-36)50-30-51(45-29-48-23-22-43(45)50)35-18-17-32-16-15-31-9-4-5-12-38(31)41(32)27-35;/h4-25,27,29-30H,1-3H3;/q-3; |
| InChIKey | NQKUMRLXAPNTNR-UHFFFAOYSA-N |
| XLogP | 11.98 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 879.90 |
| LogP ≤ 5 | 11.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|