C35H29BF3N3 — CID 164728013
12-(2,6-dimethylphenyl)-14-[4-(3,3,3-trifluoro-2,2-dimethylpropyl)phenyl]-13,15,19-triaza-12-borapentacyclo[11.6.1.02,11.04,9.016,20]icosa-1(19),2,4,6,8,10,14,16(20),17-nonaene (PubChem CID 164728013) has the molecular formula C35H29BF3N3 and a molecular weight of 559.44 g/mol. Its IUPAC name is 12-(2,6-dimethylphenyl)-14-[4-(3,3,3-trifluoro-2,2-dimethylpropyl)phenyl]-13,15,19-triaza-12-borapentacyclo[11.6.1.02,11.04,9.016,20]icosa-1(19),2,4,6,8,10,14,16(20),17-nonaene.
| Compound Name | 12-(2,6-dimethylphenyl)-14-[4-(3,3,3-trifluoro-2,2-dimethylpropyl)phenyl]-13,15,19-triaza-12-borapentacyclo[11.6.1.02,11.04,9.016,20]icosa-1(19),2,4,6,8,10,14,16(20),17-nonaene |
|---|---|
| PubChem CID | 164728013 |
| Molecular Formula | C35H29BF3N3 |
| Molecular Weight | 559.44 g/mol |
| Exact Mass | 559.24 |
| IUPAC Name | 12-(2,6-dimethylphenyl)-14-[4-(3,3,3-trifluoro-2,2-dimethylpropyl)phenyl]-13,15,19-triaza-12-borapentacyclo[11.6.1.02,11.04,9.016,20]icosa-1(19),2,4,6,8,10,14,16(20),17-nonaene |
| SMILES | Cc1cccc(C)c1B1c2cc3ccccc3cc2-c2nccc3nc(-c4ccc(CC(C)(C)C(F)(F)F)cc4)n1c23 |
| InChI | InChI=1S/C35H29BF3N3/c1-21-8-7-9-22(2)30(21)36-28-19-26-11-6-5-10-25(26)18-27(28)31-32-29(16-17-40-31)41-33(42(32)36)24-14-12-23(13-15-24)20-34(3,4)35(37,38)39/h5-19H,20H2,1-4H3 |
| InChIKey | WWUYQJYUBBTJDY-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.44 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|