C34H35BN2 — CID 166581910
8-(2,6-dimethylphenyl)-15-(3,5-dimethylphenyl)-5-(2,2-dimethylpropyl)-1,14-diaza-8-boratetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9(16),10,12,14-heptaene (PubChem CID 166581910) has the molecular formula C34H35BN2 and a molecular weight of 482.48 g/mol. Its IUPAC name is 8-(2,6-dimethylphenyl)-15-(3,5-dimethylphenyl)-5-(2,2-dimethylpropyl)-1,14-diaza-8-boratetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9(16),10,12,14-heptaene.
| Compound Name | 8-(2,6-dimethylphenyl)-15-(3,5-dimethylphenyl)-5-(2,2-dimethylpropyl)-1,14-diaza-8-boratetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9(16),10,12,14-heptaene |
|---|---|
| PubChem CID | 166581910 |
| Molecular Formula | C34H35BN2 |
| Molecular Weight | 482.48 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | 8-(2,6-dimethylphenyl)-15-(3,5-dimethylphenyl)-5-(2,2-dimethylpropyl)-1,14-diaza-8-boratetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9(16),10,12,14-heptaene |
| SMILES | Cc1cc(C)cc(-c2nc3cccc4c3n2-c2ccc(CC(C)(C)C)cc2B4c2c(C)cccc2C)c1 |
| InChI | InChI=1S/C34H35BN2/c1-21-16-22(2)18-26(17-21)33-36-29-13-9-12-27-32(29)37(33)30-15-14-25(20-34(5,6)7)19-28(30)35(27)31-23(3)10-8-11-24(31)4/h8-19H,20H2,1-7H3 |
| InChIKey | WGWAINVBGMJGBB-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.48 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|