C45H48BN3 — CID 166006492
4,19-ditert-butyl-8-(4-tert-butylphenyl)-15-(2,6-dimethylphenyl)-8,14,16-triaza-1-borahexacyclo[11.8.1.114,17.02,7.09,22.021,23]tricosa-2(7),3,5,9,11,13(22),15,17(23),18,20-decaene (PubChem CID 166006492) has the molecular formula C45H48BN3 and a molecular weight of 641.71 g/mol. Its IUPAC name is 4,19-ditert-butyl-8-(4-tert-butylphenyl)-15-(2,6-dimethylphenyl)-8,14,16-triaza-1-borahexacyclo[11.8.1.114,17.02,7.09,22.021,23]tricosa-2(7),3,5,9,11,13(22),15,17(23),18,20-decaene.
| Compound Name | 4,19-ditert-butyl-8-(4-tert-butylphenyl)-15-(2,6-dimethylphenyl)-8,14,16-triaza-1-borahexacyclo[11.8.1.114,17.02,7.09,22.021,23]tricosa-2(7),3,5,9,11,13(22),15,17(23),18,20-decaene |
|---|---|
| PubChem CID | 166006492 |
| Molecular Formula | C45H48BN3 |
| Molecular Weight | 641.71 g/mol |
| Exact Mass | 641.39 |
| IUPAC Name | 4,19-ditert-butyl-8-(4-tert-butylphenyl)-15-(2,6-dimethylphenyl)-8,14,16-triaza-1-borahexacyclo[11.8.1.114,17.02,7.09,22.021,23]tricosa-2(7),3,5,9,11,13(22),15,17(23),18,20-decaene |
| SMILES | Cc1cccc(C)c1-c1nc2cc(C(C)(C)C)cc3c2n1-c1cccc2c1B3c1cc(C(C)(C)C)ccc1N2c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C45H48BN3/c1-27-14-12-15-28(2)39(27)42-47-35-26-31(45(9,10)11)25-34-41(35)49(42)38-17-13-16-37-40(38)46(34)33-24-30(44(6,7)8)20-23-36(33)48(37)32-21-18-29(19-22-32)43(3,4)5/h12-26H,1-11H3 |
| InChIKey | IPVJGQNAWHOJJC-UHFFFAOYSA-N |
| XLogP | 9.81 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.71 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|