C45H48BN3 — CID 155714755
4-tert-butyl-8-(4-tert-butylphenyl)-15-[2,6-di(propan-2-yl)phenyl]-8,14,16-triaza-1-borahexacyclo[11.8.1.114,17.02,7.09,22.021,23]tricosa-2(7),3,5,9,11,13(22),15,17,19,21(23)-decaene (PubChem CID 155714755) has the molecular formula C45H48BN3 and a molecular weight of 641.71 g/mol. Its IUPAC name is 4-tert-butyl-8-(4-tert-butylphenyl)-15-[2,6-di(propan-2-yl)phenyl]-8,14,16-triaza-1-borahexacyclo[11.8.1.114,17.02,7.09,22.021,23]tricosa-2(7),3,5,9,11,13(22),15,17,19,21(23)-decaene.
| Compound Name | 4-tert-butyl-8-(4-tert-butylphenyl)-15-[2,6-di(propan-2-yl)phenyl]-8,14,16-triaza-1-borahexacyclo[11.8.1.114,17.02,7.09,22.021,23]tricosa-2(7),3,5,9,11,13(22),15,17,19,21(23)-decaene |
|---|---|
| PubChem CID | 155714755 |
| Molecular Formula | C45H48BN3 |
| Molecular Weight | 641.71 g/mol |
| Exact Mass | 641.39 |
| IUPAC Name | 4-tert-butyl-8-(4-tert-butylphenyl)-15-[2,6-di(propan-2-yl)phenyl]-8,14,16-triaza-1-borahexacyclo[11.8.1.114,17.02,7.09,22.021,23]tricosa-2(7),3,5,9,11,13(22),15,17,19,21(23)-decaene |
| SMILES | CC(C)c1cccc(C(C)C)c1-c1nc2cccc3c2n1-c1cccc2c1B3c1cc(C(C)(C)C)ccc1N2c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C45H48BN3/c1-27(2)32-14-11-15-33(28(3)4)40(32)43-47-36-17-12-16-34-42(36)49(43)39-19-13-18-38-41(39)46(34)35-26-30(45(8,9)10)22-25-37(35)48(38)31-23-20-29(21-24-31)44(5,6)7/h11-28H,1-10H3 |
| InChIKey | YTLDGLPNFLQQOW-UHFFFAOYSA-N |
| XLogP | 10.15 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.71 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|