C33H34BN3 — CID 166581887
15-(3,5-dimethylphenyl)-8-[2,6-di(propan-2-yl)phenyl]-11-methyl-1,12,14-triaza-8-boratetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16),14-heptaene (PubChem CID 166581887) has the molecular formula C33H34BN3 and a molecular weight of 483.47 g/mol. Its IUPAC name is 15-(3,5-dimethylphenyl)-8-[2,6-di(propan-2-yl)phenyl]-11-methyl-1,12,14-triaza-8-boratetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16),14-heptaene.
| Compound Name | 15-(3,5-dimethylphenyl)-8-[2,6-di(propan-2-yl)phenyl]-11-methyl-1,12,14-triaza-8-boratetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16),14-heptaene |
|---|---|
| PubChem CID | 166581887 |
| Molecular Formula | C33H34BN3 |
| Molecular Weight | 483.47 g/mol |
| Exact Mass | 483.28 |
| IUPAC Name | 15-(3,5-dimethylphenyl)-8-[2,6-di(propan-2-yl)phenyl]-11-methyl-1,12,14-triaza-8-boratetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16),14-heptaene |
| SMILES | Cc1cc(C)cc(-c2nc3nc(C)cc4c3n2-c2ccccc2B4c2c(C(C)C)cccc2C(C)C)c1 |
| InChI | InChI=1S/C33H34BN3/c1-19(2)25-11-10-12-26(20(3)4)30(25)34-27-13-8-9-14-29(27)37-31-28(34)18-23(7)35-32(31)36-33(37)24-16-21(5)15-22(6)17-24/h8-20H,1-7H3 |
| InChIKey | QXEQBJBMVBMYMG-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.47 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|