C22H28O6S — CID 164731936
4-[5-(1-hydroxycyclopentyl)adamantane-2-carbonyl]oxybenzenesulfonic acid (PubChem CID 164731936) has the molecular formula C22H28O6S and a molecular weight of 420.53 g/mol. Its IUPAC name is 4-[5-(1-hydroxycyclopentyl)adamantane-2-carbonyl]oxybenzenesulfonic acid.
| Compound Name | 4-[5-(1-hydroxycyclopentyl)adamantane-2-carbonyl]oxybenzenesulfonic acid |
|---|---|
| PubChem CID | 164731936 |
| Molecular Formula | C22H28O6S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 4-[5-(1-hydroxycyclopentyl)adamantane-2-carbonyl]oxybenzenesulfonic acid |
| SMILES | O=C(Oc1ccc(S(=O)(=O)O)cc1)C1C2CC3CC1CC(C1(O)CCCC1)(C3)C2 |
| InChI | InChI=1S/C22H28O6S/c23-20(28-17-3-5-18(6-4-17)29(25,26)27)19-15-9-14-10-16(19)13-21(11-14,12-15)22(24)7-1-2-8-22/h3-6,14-16,19,24H,1-2,7-13H2,(H,25,26,27) |
| InChIKey | BCQOVDHCXIGFIN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|