C18H24O4S — CID 134464473
4-(4-tricyclo[5.3.1.13,9]dodecanyloxy)benzenesulfonic acid (PubChem CID 134464473) has the molecular formula C18H24O4S and a molecular weight of 336.45 g/mol. Its IUPAC name is 4-(4-tricyclo[5.3.1.13,9]dodecanyloxy)benzenesulfonic acid.
| Compound Name | 4-(4-tricyclo[5.3.1.13,9]dodecanyloxy)benzenesulfonic acid |
|---|---|
| PubChem CID | 134464473 |
| Molecular Formula | C18H24O4S |
| Molecular Weight | 336.45 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 4-(4-tricyclo[5.3.1.13,9]dodecanyloxy)benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(OC2CCC3CC4CC(C3)CC2C4)cc1 |
| InChI | InChI=1S/C18H24O4S/c19-23(20,21)17-4-2-16(3-5-17)22-18-6-1-12-7-13-9-14(8-12)11-15(18)10-13/h2-5,12-15,18H,1,6-11H2,(H,19,20,21) |
| InChIKey | KBAJJWMPSJPGSX-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|