C28H4-2 — CID 164732411
octacosa-2,4,6,8,10,12,14,16,18,20,22,24,26-tridecayne (PubChem CID 164732411) has the molecular formula C28H4-2 and a molecular weight of 340.34 g/mol. Its IUPAC name is octacosa-2,4,6,8,10,12,14,16,18,20,22,24,26-tridecayne.
| Compound Name | octacosa-2,4,6,8,10,12,14,16,18,20,22,24,26-tridecayne |
|---|---|
| PubChem CID | 164732411 |
| Molecular Formula | C28H4-2 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | octacosa-2,4,6,8,10,12,14,16,18,20,22,24,26-tridecayne |
| SMILES | [CH2-]C#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#C[CH2-] |
| InChI | InChI=1S/C28H4/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h1-2H2/q-2 |
| InChIKey | IEIPUNOKYJYOGA-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|