C32H5- — CID 58245186
dotriaconta-2,4,6,8,10,12,14,16,18,20,22,24,26,28,30-pentadecayne (PubChem CID 58245186) has the molecular formula C32H5- and a molecular weight of 389.39 g/mol. Its IUPAC name is dotriaconta-2,4,6,8,10,12,14,16,18,20,22,24,26,28,30-pentadecayne.
| Compound Name | dotriaconta-2,4,6,8,10,12,14,16,18,20,22,24,26,28,30-pentadecayne |
|---|---|
| PubChem CID | 58245186 |
| Molecular Formula | C32H5- |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | dotriaconta-2,4,6,8,10,12,14,16,18,20,22,24,26,28,30-pentadecayne |
| SMILES | [CH2-]C#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC |
| InChI | InChI=1S/C32H5/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h1H2,2H3/q-1 |
| InChIKey | BRSXFUBEWLMNQP-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|