C43H55BiIrN3O2- — CID 164733363
7-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-2-(2,2-dimethylpropyl)-3-phenyl-[1,3]azabismolo[4,5-d]pyrimidine;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium (PubChem CID 164733363) has the molecular formula C43H55BiIrN3O2- and a molecular weight of 1047.13 g/mol. Its IUPAC name is 7-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-2-(2,2-dimethylpropyl)-3-phenyl-[1,3]azabismolo[4,5-d]pyrimidine;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium.
| Compound Name | 7-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-2-(2,2-dimethylpropyl)-3-phenyl-[1,3]azabismolo[4,5-d]pyrimidine;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
|---|---|
| PubChem CID | 164733363 |
| Molecular Formula | C43H55BiIrN3O2- |
| Molecular Weight | 1047.13 g/mol |
| Exact Mass | 1047.37 |
| IUPAC Name | 7-(4-tert-butyl-1H-naphthalen-1-id-2-yl)-2-(2,2-dimethylpropyl)-3-phenyl-[1,3]azabismolo[4,5-d]pyrimidine;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
| SMILES | CC(C)(C)CC1=Nc2c(-c3[c-]c4ccccc4c(C(C)(C)C)c3)ncnc2[Bi]1c1ccccc1.CCC(CC)C(=O)/C=C(\O)C(CC)CC.[Ir] |
| InChI | InChI=1S/C24H26N3.C13H24O2.C6H5.Bi.Ir/c1-23(2,3)11-12-26-21-15-25-16-27-22(21)18-13-17-9-7-8-10-19(17)20(14-18)24(4,5)6;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;1-2-4-6-5-3-1;;/h7-10,14,16H,11H2,1-6H3;9-11,14H,5-8H2,1-4H3;1-5H;;/q-1;;;;/b;12-9-;;; |
| InChIKey | KFLYZAJBSNHEJH-AJRJZYOCSA-N |
| XLogP | 9.93 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1047.13 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|