C70H50N4O — CID 164733789
CID 164733789 (PubChem CID 164733789) has the molecular formula C70H50N4O and a molecular weight of 982.31 g/mol.
| Compound Name | CID 164733789 |
|---|---|
| PubChem CID | 164733789 |
| Molecular Formula | C70H50N4O |
| Molecular Weight | 982.31 g/mol |
| Exact Mass | 981.52 |
| IUPAC Name | — |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cc3c4ccccc4n(-c4cc(C(C)(C)C)ccn4)c3cc2Oc2cccc(-n3[c-][n+]4c5c(cccc53)-c3ccccc3-c3c([2H])c([2H])c([2H])c([2H])c3-c3c(-c5c([2H])c([2H])c([2H])c([2H])c5[2H])ccc(-c5c([2H])c([2H])c([2H])c([2H])c5[2H])c3-4)c2)c([2H])c1[2H] |
| InChI | InChI=1S/C70H50N4O/c1-70(2,3)49-39-40-71-66(41-49)74-62-35-18-17-32-57(62)61-43-60(48-25-11-6-12-26-48)65(44-64(61)74)75-51-28-19-27-50(42-51)72-45-73-68-59(34-20-36-63(68)72)56-31-14-13-29-54(56)55-30-15-16-33-58(55)67-52(46-21-7-4-8-22-46)37-38-53(69(67)73)47-23-9-5-10-24-47/h4-44H,1-3H3/i4D,5D,6D,7D,8D,9D,10D,11D,12D,15D,16D,21D,22D,23D,24D,25D,26D,30D,33D |
| InChIKey | IUEOVPBAQKLELR-LFVMPPRHSA-N |
| XLogP | 17.60 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 982.31 |
| LogP ≤ 5 | 17.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|