C64H46BN5O — CID 164734228
CID 164734228 (PubChem CID 164734228) has the molecular formula C64H46BN5O and a molecular weight of 921.98 g/mol.
| Compound Name | CID 164734228 |
|---|---|
| PubChem CID | 164734228 |
| Molecular Formula | C64H46BN5O |
| Molecular Weight | 921.98 g/mol |
| Exact Mass | 921.44 |
| IUPAC Name | — |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cccc(-c3c([2H])c([2H])c([2H])c([2H])c3[2H])c2-[n+]2[c-]n3c4c5c(ccc42)-c2ccccc2B5N(c2ccccc2)c2ccc(Oc4ccc5c6ccccc6n(-c6cc(C(C)(C)C)ccn6)c5c4)cc2-3)c([2H])c1[2H] |
| InChI | InChI=1S/C64H46BN5O/c1-64(2,3)44-36-37-66-60(38-44)69-55-29-16-14-25-51(55)52-32-30-46(39-58(52)69)71-47-31-34-56-59(40-47)68-41-67(62-48(42-18-7-4-8-19-42)26-17-27-49(62)43-20-9-5-10-21-43)57-35-33-53-50-24-13-15-28-54(50)65(61(53)63(57)68)70(56)45-22-11-6-12-23-45/h4-40H,1-3H3/i4D,5D,7D,8D,9D,10D,18D,19D,20D,21D |
| InChIKey | LELLKVRUTGUERM-LLQGPUEHSA-N |
| XLogP | 13.86 |
| TPSA | 39.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 921.98 |
| LogP ≤ 5 | 13.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|